C12H21N3O3S — CID 64605539
2-(ethylamino)-N-(4-methoxybutan-2-yl)pyridine-4-sulfonamide (PubChem CID 64605539) has the molecular formula C12H21N3O3S and a molecular weight of 287.39 g/mol. Its IUPAC name is 2-(ethylamino)-N-(4-methoxybutan-2-yl)pyridine-4-sulfonamide.
| Compound Name | 2-(ethylamino)-N-(4-methoxybutan-2-yl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 64605539 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-(ethylamino)-N-(4-methoxybutan-2-yl)pyridine-4-sulfonamide |
| SMILES | CCNc1cc(S(=O)(=O)NC(C)CCOC)ccn1 |
| InChI | InChI=1S/C12H21N3O3S/c1-4-13-12-9-11(5-7-14-12)19(16,17)15-10(2)6-8-18-3/h5,7,9-10,15H,4,6,8H2,1-3H3,(H,13,14) |
| InChIKey | BFGWISULZVSGIM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |