C14H18N4O2S — CID 62146235
2-(ethylamino)-N-(1-pyridin-2-ylethyl)pyridine-4-sulfonamide (PubChem CID 62146235) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-(ethylamino)-N-(1-pyridin-2-ylethyl)pyridine-4-sulfonamide.
| Compound Name | 2-(ethylamino)-N-(1-pyridin-2-ylethyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 62146235 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-(ethylamino)-N-(1-pyridin-2-ylethyl)pyridine-4-sulfonamide |
| SMILES | CCNc1cc(S(=O)(=O)NC(C)c2ccccn2)ccn1 |
| InChI | InChI=1S/C14H18N4O2S/c1-3-15-14-10-12(7-9-17-14)21(19,20)18-11(2)13-6-4-5-8-16-13/h4-11,18H,3H2,1-2H3,(H,15,17) |
| InChIKey | QVHIGJMXCNFXEU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |