C13H12F2N2O2S — CID 41084343
3,5-difluoro-N-[(1S)-1-pyridin-2-ylethyl]benzenesulfonamide (PubChem CID 41084343) has the molecular formula C13H12F2N2O2S and a molecular weight of 298.31 g/mol. Its IUPAC name is 3,5-difluoro-N-[(1S)-1-pyridin-2-ylethyl]benzenesulfonamide.
| Compound Name | 3,5-difluoro-N-[(1S)-1-pyridin-2-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41084343 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3,5-difluoro-N-[(1S)-1-pyridin-2-ylethyl]benzenesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1cc(F)cc(F)c1)c1ccccn1 |
| InChI | InChI=1S/C13H12F2N2O2S/c1-9(13-4-2-3-5-16-13)17-20(18,19)12-7-10(14)6-11(15)8-12/h2-9,17H,1H3/t9-/m0/s1 |
| InChIKey | SQUFWRKGOBWPIQ-VIFPVBQESA-N |
| XLogP | 2.40 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |