C15H27N3O2S — CID 115327205
N-(5-methylhexyl)-4-(propylamino)pyridine-3-sulfonamide (PubChem CID 115327205) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is N-(5-methylhexyl)-4-(propylamino)pyridine-3-sulfonamide.
| Compound Name | N-(5-methylhexyl)-4-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115327205 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-(5-methylhexyl)-4-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ccncc1S(=O)(=O)NCCCCC(C)C |
| InChI | InChI=1S/C15H27N3O2S/c1-4-9-17-14-8-11-16-12-15(14)21(19,20)18-10-6-5-7-13(2)3/h8,11-13,18H,4-7,9-10H2,1-3H3,(H,16,17) |
| InChIKey | KSNQDUOYDLNNIA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|