C11H20N4O4S2 — CID 106342226
4-(ethylamino)-N-[3-(methanesulfonamido)propyl]pyridine-3-sulfonamide (PubChem CID 106342226) has the molecular formula C11H20N4O4S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-(ethylamino)-N-[3-(methanesulfonamido)propyl]pyridine-3-sulfonamide.
| Compound Name | 4-(ethylamino)-N-[3-(methanesulfonamido)propyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106342226 |
| Molecular Formula | C11H20N4O4S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-(ethylamino)-N-[3-(methanesulfonamido)propyl]pyridine-3-sulfonamide |
| SMILES | CCNc1ccncc1S(=O)(=O)NCCCNS(C)(=O)=O |
| InChI | InChI=1S/C11H20N4O4S2/c1-3-13-10-5-8-12-9-11(10)21(18,19)15-7-4-6-14-20(2,16)17/h5,8-9,14-15H,3-4,6-7H2,1-2H3,(H,12,13) |
| InChIKey | NYMZAMLSHIIIOW-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|