C9H12ClN3O3S — CID 88643816
1-[(4-chloro-3-pyridinyl)sulfamoyl]-N-propan-2-ylformamide (PubChem CID 88643816) has the molecular formula C9H12ClN3O3S and a molecular weight of 277.73 g/mol. Its IUPAC name is 1-[(4-chloro-3-pyridinyl)sulfamoyl]-N-propan-2-ylformamide.
| Compound Name | 1-[(4-chloro-3-pyridinyl)sulfamoyl]-N-propan-2-ylformamide |
|---|---|
| PubChem CID | 88643816 |
| Molecular Formula | C9H12ClN3O3S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 1-[(4-chloro-3-pyridinyl)sulfamoyl]-N-propan-2-ylformamide |
| SMILES | CC(C)NC(=O)S(=O)(=O)Nc1cnccc1Cl |
| InChI | InChI=1S/C9H12ClN3O3S/c1-6(2)12-9(14)17(15,16)13-8-5-11-4-3-7(8)10/h3-6,13H,1-2H3,(H,12,14) |
| InChIKey | KAEAYCVNQYOVIS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|