C9H9ClN4O2S — CID 83167318
N-(4-chloro-3-pyridinyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 83167318) has the molecular formula C9H9ClN4O2S and a molecular weight of 272.72 g/mol. Its IUPAC name is N-(4-chloro-3-pyridinyl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(4-chloro-3-pyridinyl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 83167318 |
| Molecular Formula | C9H9ClN4O2S |
| Molecular Weight | 272.72 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | N-(4-chloro-3-pyridinyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)Nc1cnccc1Cl |
| InChI | InChI=1S/C9H9ClN4O2S/c1-6-9(5-12-13-6)17(15,16)14-8-4-11-3-2-7(8)10/h2-5,14H,1H3,(H,12,13) |
| InChIKey | YQFRTVVVIXOOIQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.72 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |