C10H9ClN4O2S — CID 83164863
2-amino-N-(4-chloro-3-pyridinyl)pyridine-3-sulfonamide (PubChem CID 83164863) has the molecular formula C10H9ClN4O2S and a molecular weight of 284.73 g/mol. Its IUPAC name is 2-amino-N-(4-chloro-3-pyridinyl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-N-(4-chloro-3-pyridinyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 83164863 |
| Molecular Formula | C10H9ClN4O2S |
| Molecular Weight | 284.73 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 2-amino-N-(4-chloro-3-pyridinyl)pyridine-3-sulfonamide |
| SMILES | Nc1ncccc1S(=O)(=O)Nc1cnccc1Cl |
| InChI | InChI=1S/C10H9ClN4O2S/c11-7-3-5-13-6-8(7)15-18(16,17)9-2-1-4-14-10(9)12/h1-6,15H,(H2,12,14) |
| InChIKey | KHEDQNUMOUBJOU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.73 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |