C11H12N4O2S — CID 63672409
2-amino-N-(3-methyl-4-pyridinyl)pyridine-3-sulfonamide (PubChem CID 63672409) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-amino-N-(3-methyl-4-pyridinyl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-N-(3-methyl-4-pyridinyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63672409 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-amino-N-(3-methyl-4-pyridinyl)pyridine-3-sulfonamide |
| SMILES | Cc1cnccc1NS(=O)(=O)c1cccnc1N |
| InChI | InChI=1S/C11H12N4O2S/c1-8-7-13-6-4-9(8)15-18(16,17)10-3-2-5-14-11(10)12/h2-7H,1H3,(H2,12,14)(H,13,15) |
| InChIKey | KMMQHVIKEBLDIB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |