C9H7ClF3NO4S — CID 154231211
2-chloro-5-(methylsulfamoyl)-4-(trifluoromethyl)benzoic acid (PubChem CID 154231211) has the molecular formula C9H7ClF3NO4S and a molecular weight of 317.67 g/mol. Its IUPAC name is 2-chloro-5-(methylsulfamoyl)-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-chloro-5-(methylsulfamoyl)-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 154231211 |
| Molecular Formula | C9H7ClF3NO4S |
| Molecular Weight | 317.67 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 2-chloro-5-(methylsulfamoyl)-4-(trifluoromethyl)benzoic acid |
| SMILES | CNS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C9H7ClF3NO4S/c1-14-19(17,18)7-2-4(8(15)16)6(10)3-5(7)9(11,12)13/h2-3,14H,1H3,(H,15,16) |
| InChIKey | OWWKANNUSKNCRD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.67 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |