C8H9NO6S — CID 170855730
4,5-dihydroxy-2-(methylsulfamoyl)benzoic acid (PubChem CID 170855730) has the molecular formula C8H9NO6S and a molecular weight of 247.23 g/mol. Its IUPAC name is 4,5-dihydroxy-2-(methylsulfamoyl)benzoic acid.
| Compound Name | 4,5-dihydroxy-2-(methylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 170855730 |
| Molecular Formula | C8H9NO6S |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 4,5-dihydroxy-2-(methylsulfamoyl)benzoic acid |
| SMILES | CNS(=O)(=O)c1cc(O)c(O)cc1C(=O)O |
| InChI | InChI=1S/C8H9NO6S/c1-9-16(14,15)7-3-6(11)5(10)2-4(7)8(12)13/h2-3,9-11H,1H3,(H,12,13) |
| InChIKey | PZUVMRNPBFAFJY-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|