C7H6NaO5+ — CID 54609951
sodium 2,4,5-trihydroxybenzoic acid (PubChem CID 54609951) has the molecular formula C7H6NaO5+ and a molecular weight of 193.11 g/mol. Its IUPAC name is sodium 2,4,5-trihydroxybenzoic acid.
| Compound Name | sodium 2,4,5-trihydroxybenzoic acid |
|---|---|
| PubChem CID | 54609951 |
| Molecular Formula | C7H6NaO5+ |
| Molecular Weight | 193.11 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | sodium 2,4,5-trihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)c(O)cc1O.[Na+] |
| InChI | InChI=1S/C7H6O5.Na/c8-4-2-6(10)5(9)1-3(4)7(11)12;/h1-2,8-10H,(H,11,12);/q;+1 |
| InChIKey | LEALPXVIIOBZJI-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.11 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|