C10H10O8 — CID 170824492
5-(2-carboxy-1,2-dihydroxyethyl)-2,4-dihydroxybenzoic acid (PubChem CID 170824492) has the molecular formula C10H10O8 and a molecular weight of 258.18 g/mol. Its IUPAC name is 5-(2-carboxy-1,2-dihydroxyethyl)-2,4-dihydroxybenzoic acid.
| Compound Name | 5-(2-carboxy-1,2-dihydroxyethyl)-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 170824492 |
| Molecular Formula | C10H10O8 |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 5-(2-carboxy-1,2-dihydroxyethyl)-2,4-dihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(C(O)C(O)C(=O)O)c(O)cc1O |
| InChI | InChI=1S/C10H10O8/c11-5-2-6(12)4(9(15)16)1-3(5)7(13)8(14)10(17)18/h1-2,7-8,11-14H,(H,15,16)(H,17,18) |
| InChIKey | KVSVJSYUEGBGSL-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |