C8H8O5 — CID 115016614
4,5-dihydroxy-2-(hydroxymethyl)benzoic acid (PubChem CID 115016614) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 4,5-dihydroxy-2-(hydroxymethyl)benzoic acid.
| Compound Name | 4,5-dihydroxy-2-(hydroxymethyl)benzoic acid |
|---|---|
| PubChem CID | 115016614 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 4,5-dihydroxy-2-(hydroxymethyl)benzoic acid |
| SMILES | O=C(O)c1cc(O)c(O)cc1CO |
| InChI | InChI=1S/C8H8O5/c9-3-4-1-6(10)7(11)2-5(4)8(12)13/h1-2,9-11H,3H2,(H,12,13) |
| InChIKey | LDUMKSUOEVRFLP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|