About 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid
3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid (PubChem CID 165394364) has the molecular formula C14H14O5
and a molecular weight of 262.26 g/mol. Its IUPAC name is 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid.
Analyze 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid?
The IUPAC name of 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid (CID 165394364) is 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid.
What is the SMILES notation for 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid?
The canonical SMILES for 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid is COc1cc2cc(CO)c(C(=O)O)cc2cc1OC.
What is the InChIKey of 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid?
The InChIKey is QIXXRLXLVPYYOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O5/c1-18-12-5-8-3-10(7-15)11(14(16)17)4-9(8)6-13(12)19-2/h3-6,15H,7H2,1-2H3,(H,16,17).
What are the key properties of 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid?
3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid has a molecular weight of 262.26 g/mol, XLogP of 2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylic acid is sourced from PubChem (CID 165394364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).