C14H13NaO5 — CID 165394363
sodium 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylate (PubChem CID 165394363) has the molecular formula C14H13NaO5 and a molecular weight of 284.24 g/mol. Its IUPAC name is sodium 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylate.
| Compound Name | sodium 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 165394363 |
| Molecular Formula | C14H13NaO5 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | sodium 3-(hydroxymethyl)-6,7-dimethoxynaphthalene-2-carboxylate |
| SMILES | COc1cc2cc(CO)c(C(=O)[O-])cc2cc1OC.[Na+] |
| InChI | InChI=1S/C14H14O5.Na/c1-18-12-5-8-3-10(7-15)11(14(16)17)4-9(8)6-13(12)19-2;/h3-6,15H,7H2,1-2H3,(H,16,17);/q;+1/p-1 |
| InChIKey | ZSZSAZYIWQWJBA-UHFFFAOYSA-M |
| XLogP | -2.28 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |