C14H18NO5- — CID 2221824
4,5-dimethoxy-2-[[(2S)-2-methylbutanoyl]amino]benzoate (PubChem CID 2221824) has the molecular formula C14H18NO5- and a molecular weight of 280.30 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[[(2S)-2-methylbutanoyl]amino]benzoate.
| Compound Name | 4,5-dimethoxy-2-[[(2S)-2-methylbutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 2221824 |
| Molecular Formula | C14H18NO5- |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4,5-dimethoxy-2-[[(2S)-2-methylbutanoyl]amino]benzoate |
| SMILES | CC[C@H](C)C(=O)Nc1cc(OC)c(OC)cc1C(=O)[O-] |
| InChI | InChI=1S/C14H19NO5/c1-5-8(2)13(16)15-10-7-12(20-4)11(19-3)6-9(10)14(17)18/h6-8H,5H2,1-4H3,(H,15,16)(H,17,18)/p-1/t8-/m0/s1 |
| InChIKey | KUWWNEHRGFOXRY-QMMMGPOBSA-M |
| XLogP | 1.05 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |