C10H9Cl2O3- — CID 6920239
2-(2,2-dichloroethyl)-5-methoxybenzoate (PubChem CID 6920239) has the molecular formula C10H9Cl2O3- and a molecular weight of 248.08 g/mol. Its IUPAC name is 2-(2,2-dichloroethyl)-5-methoxybenzoate.
| Compound Name | 2-(2,2-dichloroethyl)-5-methoxybenzoate |
|---|---|
| PubChem CID | 6920239 |
| Molecular Formula | C10H9Cl2O3- |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | 2-(2,2-dichloroethyl)-5-methoxybenzoate |
| SMILES | COc1ccc(CC(Cl)Cl)c(C(=O)[O-])c1 |
| InChI | InChI=1S/C10H10Cl2O3/c1-15-7-3-2-6(4-9(11)12)8(5-7)10(13)14/h2-3,5,9H,4H2,1H3,(H,13,14)/p-1 |
| InChIKey | KAIPNMLLMNTURT-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|