C9H11NO4 — CID 117286645
5-(2-aminoethyl)-2,4-dihydroxybenzoic acid (PubChem CID 117286645) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 5-(2-aminoethyl)-2,4-dihydroxybenzoic acid.
| Compound Name | 5-(2-aminoethyl)-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 117286645 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-(2-aminoethyl)-2,4-dihydroxybenzoic acid |
| SMILES | NCCc1cc(C(=O)O)c(O)cc1O |
| InChI | InChI=1S/C9H11NO4/c10-2-1-5-3-6(9(13)14)8(12)4-7(5)11/h3-4,11-12H,1-2,10H2,(H,13,14) |
| InChIKey | UESPRDMHKCHDEN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |