C13H17Cl2NO4S — CID 115581011
2,4-dichloro-5-(3,3-dimethylbutylsulfamoyl)benzoic acid (PubChem CID 115581011) has the molecular formula C13H17Cl2NO4S and a molecular weight of 354.26 g/mol. Its IUPAC name is 2,4-dichloro-5-(3,3-dimethylbutylsulfamoyl)benzoic acid.
| Compound Name | 2,4-dichloro-5-(3,3-dimethylbutylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 115581011 |
| Molecular Formula | C13H17Cl2NO4S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2,4-dichloro-5-(3,3-dimethylbutylsulfamoyl)benzoic acid |
| SMILES | CC(C)(C)CCNS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO4S/c1-13(2,3)4-5-16-21(19,20)11-6-8(12(17)18)9(14)7-10(11)15/h6-7,16H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | JOEKJMDFDAPQNC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |