C11H13Cl2NO5S — CID 43081929
2,4-dichloro-5-(1-methoxypropan-2-ylsulfamoyl)benzoic acid (PubChem CID 43081929) has the molecular formula C11H13Cl2NO5S and a molecular weight of 342.20 g/mol. Its IUPAC name is 2,4-dichloro-5-(1-methoxypropan-2-ylsulfamoyl)benzoic acid.
| Compound Name | 2,4-dichloro-5-(1-methoxypropan-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 43081929 |
| Molecular Formula | C11H13Cl2NO5S |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2,4-dichloro-5-(1-methoxypropan-2-ylsulfamoyl)benzoic acid |
| SMILES | COCC(C)NS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2NO5S/c1-6(5-19-2)14-20(17,18)10-3-7(11(15)16)8(12)4-9(10)13/h3-4,6,14H,5H2,1-2H3,(H,15,16) |
| InChIKey | HUYAJAGQRJYUBA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |