C13H13Cl2NO4S — CID 106224222
2,4-dichloro-5-(hex-1-yn-3-ylsulfamoyl)benzoic acid (PubChem CID 106224222) has the molecular formula C13H13Cl2NO4S and a molecular weight of 350.22 g/mol. Its IUPAC name is 2,4-dichloro-5-(hex-1-yn-3-ylsulfamoyl)benzoic acid.
| Compound Name | 2,4-dichloro-5-(hex-1-yn-3-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 106224222 |
| Molecular Formula | C13H13Cl2NO4S |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 2,4-dichloro-5-(hex-1-yn-3-ylsulfamoyl)benzoic acid |
| SMILES | C#CC(CCC)NS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2NO4S/c1-3-5-8(4-2)16-21(19,20)12-6-9(13(17)18)10(14)7-11(12)15/h2,6-8,16H,3,5H2,1H3,(H,17,18) |
| InChIKey | QCQTXQINFWTTLX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|