C14H21Cl2N3O3S — CID 9179630
2,4-dichloro-5-(dimethylaminocarbamoyl)-N-[(2R)-pentan-2-yl]benzenesulfonamide (PubChem CID 9179630) has the molecular formula C14H21Cl2N3O3S and a molecular weight of 382.31 g/mol. Its IUPAC name is 2,4-dichloro-5-(dimethylaminocarbamoyl)-N-[(2R)-pentan-2-yl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-5-(dimethylaminocarbamoyl)-N-[(2R)-pentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 9179630 |
| Molecular Formula | C14H21Cl2N3O3S |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 2,4-dichloro-5-(dimethylaminocarbamoyl)-N-[(2R)-pentan-2-yl]benzenesulfonamide |
| SMILES | CCC[C@@H](C)NS(=O)(=O)c1cc(C(=O)NN(C)C)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H21Cl2N3O3S/c1-5-6-9(2)18-23(21,22)13-7-10(11(15)8-12(13)16)14(20)17-19(3)4/h7-9,18H,5-6H2,1-4H3,(H,17,20)/t9-/m1/s1 |
| InChIKey | FGTNVQMUVJPCNM-SECBINFHSA-N |
| XLogP | 2.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|