C12H12BrCl2NO2S — CID 106228954
4-bromo-2,6-dichloro-N-hex-1-yn-3-ylbenzenesulfonamide (PubChem CID 106228954) has the molecular formula C12H12BrCl2NO2S and a molecular weight of 385.11 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-hex-1-yn-3-ylbenzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-hex-1-yn-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 106228954 |
| Molecular Formula | C12H12BrCl2NO2S |
| Molecular Weight | 385.11 g/mol |
| Exact Mass | 382.91 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-hex-1-yn-3-ylbenzenesulfonamide |
| SMILES | C#CC(CCC)NS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C12H12BrCl2NO2S/c1-3-5-9(4-2)16-19(17,18)12-10(14)6-8(13)7-11(12)15/h2,6-7,9,16H,3,5H2,1H3 |
| InChIKey | OYZFWDUMKYVLFM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.11 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|