C14H20BrCl2NO2S — CID 60639898
4-bromo-2,6-dichloro-N-(6-methylheptan-2-yl)benzenesulfonamide (PubChem CID 60639898) has the molecular formula C14H20BrCl2NO2S and a molecular weight of 417.20 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(6-methylheptan-2-yl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(6-methylheptan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 60639898 |
| Molecular Formula | C14H20BrCl2NO2S |
| Molecular Weight | 417.20 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(6-methylheptan-2-yl)benzenesulfonamide |
| SMILES | CC(C)CCCC(C)NS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C14H20BrCl2NO2S/c1-9(2)5-4-6-10(3)18-21(19,20)14-12(16)7-11(15)8-13(14)17/h7-10,18H,4-6H2,1-3H3 |
| InChIKey | OODWOPPVPDFKMF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.20 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |