C13H20Cl2N2O2S — CID 64608367
5,6-dichloro-N-(6-methylheptan-2-yl)pyridine-3-sulfonamide (PubChem CID 64608367) has the molecular formula C13H20Cl2N2O2S and a molecular weight of 339.29 g/mol. Its IUPAC name is 5,6-dichloro-N-(6-methylheptan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(6-methylheptan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608367 |
| Molecular Formula | C13H20Cl2N2O2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 5,6-dichloro-N-(6-methylheptan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(C)CCCC(C)NS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H20Cl2N2O2S/c1-9(2)5-4-6-10(3)17-20(18,19)11-7-12(14)13(15)16-8-11/h7-10,17H,4-6H2,1-3H3 |
| InChIKey | CQGAQJIOTCJRAW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|