C9H10Cl2N2O2S — CID 115692267
N-but-3-en-2-yl-5,6-dichloropyridine-3-sulfonamide (PubChem CID 115692267) has the molecular formula C9H10Cl2N2O2S and a molecular weight of 281.16 g/mol. Its IUPAC name is N-but-3-en-2-yl-5,6-dichloropyridine-3-sulfonamide.
| Compound Name | N-but-3-en-2-yl-5,6-dichloropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115692267 |
| Molecular Formula | C9H10Cl2N2O2S |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | N-but-3-en-2-yl-5,6-dichloropyridine-3-sulfonamide |
| SMILES | C=CC(C)NS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2O2S/c1-3-6(2)13-16(14,15)7-4-8(10)9(11)12-5-7/h3-6,13H,1H2,2H3 |
| InChIKey | LRQVUPANMNQMER-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|