C11H16Cl2N2O2S2 — CID 115662752
5,6-dichloro-N-(4-ethylsulfanylbutan-2-yl)pyridine-3-sulfonamide (PubChem CID 115662752) has the molecular formula C11H16Cl2N2O2S2 and a molecular weight of 343.30 g/mol. Its IUPAC name is 5,6-dichloro-N-(4-ethylsulfanylbutan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(4-ethylsulfanylbutan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115662752 |
| Molecular Formula | C11H16Cl2N2O2S2 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 5,6-dichloro-N-(4-ethylsulfanylbutan-2-yl)pyridine-3-sulfonamide |
| SMILES | CCSCCC(C)NS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H16Cl2N2O2S2/c1-3-18-5-4-8(2)15-19(16,17)9-6-10(12)11(13)14-7-9/h6-8,15H,3-5H2,1-2H3 |
| InChIKey | IALQYOQHCJPURY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|