C11H11Cl2N3O2S2 — CID 115681420
5,6-dichloro-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 115681420) has the molecular formula C11H11Cl2N3O2S2 and a molecular weight of 352.27 g/mol. Its IUPAC name is 5,6-dichloro-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115681420 |
| Molecular Formula | C11H11Cl2N3O2S2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 5,6-dichloro-N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | Cc1cnc(C(C)NS(=O)(=O)c2cnc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C11H11Cl2N3O2S2/c1-6-4-15-11(19-6)7(2)16-20(17,18)8-3-9(12)10(13)14-5-8/h3-5,7,16H,1-2H3 |
| InChIKey | SIYSQOACPHETMS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|