C8H14N2O2S2 — CID 115681436
N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]ethanesulfonamide (PubChem CID 115681436) has the molecular formula C8H14N2O2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]ethanesulfonamide.
| Compound Name | N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 115681436 |
| Molecular Formula | C8H14N2O2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC(C)c1ncc(C)s1 |
| InChI | InChI=1S/C8H14N2O2S2/c1-4-14(11,12)10-7(3)8-9-5-6(2)13-8/h5,7,10H,4H2,1-3H3 |
| InChIKey | XCRXVDPPCSKPTG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |