C11H18N2O4S2 — CID 112697354
methyl 4-[1-(5-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]butanoate (PubChem CID 112697354) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is methyl 4-[1-(5-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]butanoate.
| Compound Name | methyl 4-[1-(5-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]butanoate |
|---|---|
| PubChem CID | 112697354 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | methyl 4-[1-(5-methyl-1,3-thiazol-2-yl)ethylsulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NC(C)c1ncc(C)s1 |
| InChI | InChI=1S/C11H18N2O4S2/c1-8-7-12-11(18-8)9(2)13-19(15,16)6-4-5-10(14)17-3/h7,9,13H,4-6H2,1-3H3 |
| InChIKey | ZCOUBWVKFUYIQY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |