C9H16N4O4S — CID 103943303
methyl 4-[1-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]butanoate (PubChem CID 103943303) has the molecular formula C9H16N4O4S and a molecular weight of 276.32 g/mol. Its IUPAC name is methyl 4-[1-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]butanoate.
| Compound Name | methyl 4-[1-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]butanoate |
|---|---|
| PubChem CID | 103943303 |
| Molecular Formula | C9H16N4O4S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | methyl 4-[1-(1H-1,2,4-triazol-5-yl)ethylsulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C9H16N4O4S/c1-7(9-10-6-11-12-9)13-18(15,16)5-3-4-8(14)17-2/h6-7,13H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | YLABPDOBRIEHMA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |