C14H20FNO4S — CID 62995687
methyl 4-[1-(4-fluorophenyl)propan-2-ylsulfamoyl]butanoate (PubChem CID 62995687) has the molecular formula C14H20FNO4S and a molecular weight of 317.38 g/mol. Its IUPAC name is methyl 4-[1-(4-fluorophenyl)propan-2-ylsulfamoyl]butanoate.
| Compound Name | methyl 4-[1-(4-fluorophenyl)propan-2-ylsulfamoyl]butanoate |
|---|---|
| PubChem CID | 62995687 |
| Molecular Formula | C14H20FNO4S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | methyl 4-[1-(4-fluorophenyl)propan-2-ylsulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NC(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FNO4S/c1-11(10-12-5-7-13(15)8-6-12)16-21(18,19)9-3-4-14(17)20-2/h5-8,11,16H,3-4,9-10H2,1-2H3 |
| InChIKey | HCLMVQUQLQPISK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |