C9H16F3NO4S — CID 104854823
methyl 4-(4,4,4-trifluorobutan-2-ylsulfamoyl)butanoate (PubChem CID 104854823) has the molecular formula C9H16F3NO4S and a molecular weight of 291.29 g/mol. Its IUPAC name is methyl 4-(4,4,4-trifluorobutan-2-ylsulfamoyl)butanoate.
| Compound Name | methyl 4-(4,4,4-trifluorobutan-2-ylsulfamoyl)butanoate |
|---|---|
| PubChem CID | 104854823 |
| Molecular Formula | C9H16F3NO4S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | methyl 4-(4,4,4-trifluorobutan-2-ylsulfamoyl)butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NC(C)CC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO4S/c1-7(6-9(10,11)12)13-18(15,16)5-3-4-8(14)17-2/h7,13H,3-6H2,1-2H3 |
| InChIKey | ANMSCLXJOSFZAX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |