C13H18FNO4S — CID 81350625
methyl 4-[[(1S)-1-(4-fluorophenyl)ethyl]sulfamoyl]butanoate (PubChem CID 81350625) has the molecular formula C13H18FNO4S and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl 4-[[(1S)-1-(4-fluorophenyl)ethyl]sulfamoyl]butanoate.
| Compound Name | methyl 4-[[(1S)-1-(4-fluorophenyl)ethyl]sulfamoyl]butanoate |
|---|---|
| PubChem CID | 81350625 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | methyl 4-[[(1S)-1-(4-fluorophenyl)ethyl]sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)N[C@@H](C)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO4S/c1-10(11-5-7-12(14)8-6-11)15-20(17,18)9-3-4-13(16)19-2/h5-8,10,15H,3-4,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | BDWBPRSEJHUITP-JTQLQIEISA-N |
| XLogP | 1.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |