C14H21NO5S — CID 81353565
methyl 4-[[(1R)-1-(4-methoxyphenyl)ethyl]sulfamoyl]butanoate (PubChem CID 81353565) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is methyl 4-[[(1R)-1-(4-methoxyphenyl)ethyl]sulfamoyl]butanoate.
| Compound Name | methyl 4-[[(1R)-1-(4-methoxyphenyl)ethyl]sulfamoyl]butanoate |
|---|---|
| PubChem CID | 81353565 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl 4-[[(1R)-1-(4-methoxyphenyl)ethyl]sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)N[C@H](C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H21NO5S/c1-11(12-6-8-13(19-2)9-7-12)15-21(17,18)10-4-5-14(16)20-3/h6-9,11,15H,4-5,10H2,1-3H3/t11-/m1/s1 |
| InChIKey | DFUKFLZKDKQFRH-LLVKDONJSA-N |
| XLogP | 1.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |