C12H17ClFNO2S — CID 62997355
3-chloro-N-[1-(4-fluorophenyl)propan-2-yl]propane-1-sulfonamide (PubChem CID 62997355) has the molecular formula C12H17ClFNO2S and a molecular weight of 293.79 g/mol. Its IUPAC name is 3-chloro-N-[1-(4-fluorophenyl)propan-2-yl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[1-(4-fluorophenyl)propan-2-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 62997355 |
| Molecular Formula | C12H17ClFNO2S |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-chloro-N-[1-(4-fluorophenyl)propan-2-yl]propane-1-sulfonamide |
| SMILES | CC(Cc1ccc(F)cc1)NS(=O)(=O)CCCCl |
| InChI | InChI=1S/C12H17ClFNO2S/c1-10(15-18(16,17)8-2-7-13)9-11-3-5-12(14)6-4-11/h3-6,10,15H,2,7-9H2,1H3 |
| InChIKey | STBCOJFKJUUOJV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|