C12H16ClF2NO2S — CID 116815561
4-chloro-N-[1-(2,4-difluorophenyl)ethyl]butane-1-sulfonamide (PubChem CID 116815561) has the molecular formula C12H16ClF2NO2S and a molecular weight of 311.78 g/mol. Its IUPAC name is 4-chloro-N-[1-(2,4-difluorophenyl)ethyl]butane-1-sulfonamide.
| Compound Name | 4-chloro-N-[1-(2,4-difluorophenyl)ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 116815561 |
| Molecular Formula | C12H16ClF2NO2S |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-chloro-N-[1-(2,4-difluorophenyl)ethyl]butane-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)CCCCCl)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H16ClF2NO2S/c1-9(11-5-4-10(14)8-12(11)15)16-19(17,18)7-3-2-6-13/h4-5,8-9,16H,2-3,6-7H2,1H3 |
| InChIKey | YXGYXGGCUQJLEI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|