C10H16ClNO2S2 — CID 102676201
4-chloro-N-[(1R)-1-thiophen-2-ylethyl]butane-1-sulfonamide (PubChem CID 102676201) has the molecular formula C10H16ClNO2S2 and a molecular weight of 281.83 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-1-thiophen-2-ylethyl]butane-1-sulfonamide.
| Compound Name | 4-chloro-N-[(1R)-1-thiophen-2-ylethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 102676201 |
| Molecular Formula | C10H16ClNO2S2 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 4-chloro-N-[(1R)-1-thiophen-2-ylethyl]butane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCCCl)c1cccs1 |
| InChI | InChI=1S/C10H16ClNO2S2/c1-9(10-5-4-7-15-10)12-16(13,14)8-3-2-6-11/h4-5,7,9,12H,2-3,6,8H2,1H3/t9-/m1/s1 |
| InChIKey | MCOLMJXXDOPHSL-SECBINFHSA-N |
| XLogP | 2.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|