C13H20ClNO2S2 — CID 54877167
3-chloro-N-[cyclopentyl(thiophen-2-yl)methyl]propane-1-sulfonamide (PubChem CID 54877167) has the molecular formula C13H20ClNO2S2 and a molecular weight of 321.90 g/mol. Its IUPAC name is 3-chloro-N-[cyclopentyl(thiophen-2-yl)methyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[cyclopentyl(thiophen-2-yl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 54877167 |
| Molecular Formula | C13H20ClNO2S2 |
| Molecular Weight | 321.90 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-chloro-N-[cyclopentyl(thiophen-2-yl)methyl]propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NC(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C13H20ClNO2S2/c14-8-4-10-19(16,17)15-13(11-5-1-2-6-11)12-7-3-9-18-12/h3,7,9,11,13,15H,1-2,4-6,8,10H2 |
| InChIKey | TZRQWRKOTLSJRL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|