C8H16N4O3S — CID 103885469
3-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propane-1-sulfonamide (PubChem CID 103885469) has the molecular formula C8H16N4O3S and a molecular weight of 248.31 g/mol. Its IUPAC name is 3-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propane-1-sulfonamide.
| Compound Name | 3-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 103885469 |
| Molecular Formula | C8H16N4O3S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 3-methoxy-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propane-1-sulfonamide |
| SMILES | COCCCS(=O)(=O)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C8H16N4O3S/c1-7(8-9-6-10-11-8)12-16(13,14)5-3-4-15-2/h6-7,12H,3-5H2,1-2H3,(H,9,10,11) |
| InChIKey | BBCMFEXVSOMSRH-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|