C9H17N5O2S — CID 113345805
N-[1-(1H-1,2,4-triazol-5-yl)ethyl]piperidine-1-sulfonamide (PubChem CID 113345805) has the molecular formula C9H17N5O2S and a molecular weight of 259.33 g/mol. Its IUPAC name is N-[1-(1H-1,2,4-triazol-5-yl)ethyl]piperidine-1-sulfonamide.
| Compound Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 113345805 |
| Molecular Formula | C9H17N5O2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-[1-(1H-1,2,4-triazol-5-yl)ethyl]piperidine-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)N1CCCCC1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H17N5O2S/c1-8(9-10-7-11-12-9)13-17(15,16)14-5-3-2-4-6-14/h7-8,13H,2-6H2,1H3,(H,10,11,12) |
| InChIKey | OYKCZRIPKMXBRU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |