C9H17N5O2S — CID 64530904
N-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine-1-sulfonamide (PubChem CID 64530904) has the molecular formula C9H17N5O2S and a molecular weight of 259.33 g/mol. Its IUPAC name is N-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine-1-sulfonamide.
| Compound Name | N-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 64530904 |
| Molecular Formula | C9H17N5O2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-[2-(1H-1,2,4-triazol-5-yl)ethyl]piperidine-1-sulfonamide |
| SMILES | O=S(=O)(NCCc1ncn[nH]1)N1CCCCC1 |
| InChI | InChI=1S/C9H17N5O2S/c15-17(16,14-6-2-1-3-7-14)12-5-4-9-10-8-11-13-9/h8,12H,1-7H2,(H,10,11,13) |
| InChIKey | DUUUGTIBKGSKGQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |