C11H21N5O2S — CID 131890041
N-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]azepane-1-sulfonamide (PubChem CID 131890041) has the molecular formula C11H21N5O2S and a molecular weight of 287.39 g/mol. Its IUPAC name is N-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]azepane-1-sulfonamide.
| Compound Name | N-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]azepane-1-sulfonamide |
|---|---|
| PubChem CID | 131890041 |
| Molecular Formula | C11H21N5O2S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]azepane-1-sulfonamide |
| SMILES | Cn1ncnc1CCNS(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C11H21N5O2S/c1-15-11(12-10-13-15)6-7-14-19(17,18)16-8-4-2-3-5-9-16/h10,14H,2-9H2,1H3 |
| InChIKey | FKNCSGQIBKFDKQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |