C16H28N6O2S — CID 37302509
N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperidine-1-sulfonamide (PubChem CID 37302509) has the molecular formula C16H28N6O2S and a molecular weight of 368.51 g/mol. Its IUPAC name is N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperidine-1-sulfonamide.
| Compound Name | N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 37302509 |
| Molecular Formula | C16H28N6O2S |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]piperidine-1-sulfonamide |
| SMILES | O=S(=O)(NCCCN1CCN(c2ncccn2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C16H28N6O2S/c23-25(24,22-10-2-1-3-11-22)19-8-5-9-20-12-14-21(15-13-20)16-17-6-4-7-18-16/h4,6-7,19H,1-3,5,8-15H2 |
| InChIKey | XHMADFXAJPTHQG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|