C20H27N5O2S — CID 55906148
2-(4-methylphenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]ethenesulfonamide (PubChem CID 55906148) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]ethenesulfonamide.
| Compound Name | 2-(4-methylphenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]ethenesulfonamide |
|---|---|
| PubChem CID | 55906148 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 2-(4-methylphenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]ethenesulfonamide |
| SMILES | Cc1ccc(C=CS(=O)(=O)NCCCN2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C20H27N5O2S/c1-18-4-6-19(7-5-18)8-17-28(26,27)23-11-3-12-24-13-15-25(16-14-24)20-21-9-2-10-22-20/h2,4-10,17,23H,3,11-16H2,1H3 |
| InChIKey | PWIGPAKQWHULOJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|