C19H31N7O2S — CID 19438727
N-butyl-1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrazole-4-sulfonamide (PubChem CID 19438727) has the molecular formula C19H31N7O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is N-butyl-1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrazole-4-sulfonamide.
| Compound Name | N-butyl-1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 19438727 |
| Molecular Formula | C19H31N7O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | N-butyl-1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrazole-4-sulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cnn(CCCCN2CCN(c3ncccn3)CC2)c1 |
| InChI | InChI=1S/C19H31N7O2S/c1-2-3-9-23-29(27,28)18-16-22-26(17-18)11-5-4-10-24-12-14-25(15-13-24)19-20-7-6-8-21-19/h6-8,16-17,23H,2-5,9-15H2,1H3 |
| InChIKey | NEDVIBIVXGBQET-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|