C16H23N7O — CID 15788033
1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrazole-4-carboxamide (PubChem CID 15788033) has the molecular formula C16H23N7O and a molecular weight of 329.41 g/mol. Its IUPAC name is 1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrazole-4-carboxamide.
| Compound Name | 1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 15788033 |
| Molecular Formula | C16H23N7O |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(CCCCN2CCN(c3ncccn3)CC2)c1 |
| InChI | InChI=1S/C16H23N7O/c17-15(24)14-12-20-23(13-14)7-2-1-6-21-8-10-22(11-9-21)16-18-4-3-5-19-16/h3-5,12-13H,1-2,6-11H2,(H2,17,24) |
| InChIKey | BOHGSEVDLNTOQO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|