C12H19N5O2 — CID 142706032
2-[4-(2-methoxyethyl)piperazin-1-yl]pyrimidine-5-carboxamide (PubChem CID 142706032) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-[4-(2-methoxyethyl)piperazin-1-yl]pyrimidine-5-carboxamide.
| Compound Name | 2-[4-(2-methoxyethyl)piperazin-1-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142706032 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-[4-(2-methoxyethyl)piperazin-1-yl]pyrimidine-5-carboxamide |
| SMILES | COCCN1CCN(c2ncc(C(N)=O)cn2)CC1 |
| InChI | InChI=1S/C12H19N5O2/c1-19-7-6-16-2-4-17(5-3-16)12-14-8-10(9-15-12)11(13)18/h8-9H,2-7H2,1H3,(H2,13,18) |
| InChIKey | YRQPOGAVIQMAST-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |