C16H25ClN4O4 — CID 155272571
2-[4-[3-chloro-5-(2-methoxyethoxy)-2-pyridinyl]piperazin-1-yl]ethyl N-methylcarbamate (PubChem CID 155272571) has the molecular formula C16H25ClN4O4 and a molecular weight of 372.85 g/mol. Its IUPAC name is 2-[4-[3-chloro-5-(2-methoxyethoxy)-2-pyridinyl]piperazin-1-yl]ethyl N-methylcarbamate.
| Compound Name | 2-[4-[3-chloro-5-(2-methoxyethoxy)-2-pyridinyl]piperazin-1-yl]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 155272571 |
| Molecular Formula | C16H25ClN4O4 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[4-[3-chloro-5-(2-methoxyethoxy)-2-pyridinyl]piperazin-1-yl]ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCN1CCN(c2ncc(OCCOC)cc2Cl)CC1 |
| InChI | InChI=1S/C16H25ClN4O4/c1-18-16(22)25-8-7-20-3-5-21(6-4-20)15-14(17)11-13(12-19-15)24-10-9-23-2/h11-12H,3-10H2,1-2H3,(H,18,22) |
| InChIKey | CLGBXTAHRWYCHR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|